About 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione
8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione (PubChem CID 14002667) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione.
Molecular Properties
| Compound Name | 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione |
| PubChem CID | 14002667 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione |
| SMILES | O=C1OC(=O)C23CC=CCC12CCC3 |
| InChI | InChI=1S/C11H12O3/c12-8-10-4-1-2-5-11(10,7-3-6-10)9(13)14-8/h1-2H,3-7H2 |
| InChIKey | WDODBMCCVSCIFF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione?
The IUPAC name of 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione (CID 14002667) is 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione.
What is the SMILES notation for 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione?
The canonical SMILES for 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione is O=C1OC(=O)C23CC=CCC12CCC3.
What is the InChIKey of 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione?
The InChIKey is WDODBMCCVSCIFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3/c12-8-10-4-1-2-5-11(10,7-3-6-10)9(13)14-8/h1-2H,3-7H2.
What are the key properties of 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione?
8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione has a molecular weight of 192.21 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxatricyclo[4.3.3.01,6]dodec-3-ene-7,9-dione is sourced from PubChem (CID 14002667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).