C18H27O11P — CID 14003139
tetramethyl 1,1,2-triethoxy-1lambda5-phosphacyclopenta-3,5-diene-2,3,4,5-tetracarboxylate (PubChem CID 14003139) has the molecular formula C18H27O11P and a molecular weight of 450.38 g/mol. Its IUPAC name is tetramethyl 1,1,2-triethoxy-1lambda5-phosphacyclopenta-3,5-diene-2,3,4,5-tetracarboxylate.
| Compound Name | tetramethyl 1,1,2-triethoxy-1lambda5-phosphacyclopenta-3,5-diene-2,3,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 14003139 |
| Molecular Formula | C18H27O11P |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | tetramethyl 1,1,2-triethoxy-1lambda5-phosphacyclopenta-3,5-diene-2,3,4,5-tetracarboxylate |
| SMILES | CCOC1(C(=O)OC)C(C(=O)OC)=C(C(=O)OC)C(C(=O)OC)=P1(OCC)OCC |
| InChI | InChI=1S/C18H27O11P/c1-8-27-18(17(22)26-7)12(15(20)24-5)11(14(19)23-4)13(16(21)25-6)30(18,28-9-2)29-10-3/h8-10H2,1-7H3 |
| InChIKey | NVVJVXOLYYFVMT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|