C14H10N4O3 — CID 14003825
6-[(E)-2-phenylethenyl]-1,8-dihydropteridine-2,4,7-trione (PubChem CID 14003825) has the molecular formula C14H10N4O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is 6-[(E)-2-phenylethenyl]-1,8-dihydropteridine-2,4,7-trione.
| Compound Name | 6-[(E)-2-phenylethenyl]-1,8-dihydropteridine-2,4,7-trione |
|---|---|
| PubChem CID | 14003825 |
| Molecular Formula | C14H10N4O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 6-[(E)-2-phenylethenyl]-1,8-dihydropteridine-2,4,7-trione |
| SMILES | O=c1[nH]c(=O)c2nc(/C=C/c3ccccc3)c(=O)[nH]c2[nH]1 |
| InChI | InChI=1S/C14H10N4O3/c19-12-9(7-6-8-4-2-1-3-5-8)15-10-11(16-12)17-14(21)18-13(10)20/h1-7H,(H3,16,17,18,19,20,21)/b7-6+ |
| InChIKey | FZPRRZWZWHVKSW-VOTSOKGWSA-N |
| XLogP | 0.47 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |