C12H19N — CID 14003979
(8aS,9aR)-2,3,4,5,6,7,8,8a,9,9a-decahydro-1H-carbazole (PubChem CID 14003979) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (8aS,9aR)-2,3,4,5,6,7,8,8a,9,9a-decahydro-1H-carbazole.
| Compound Name | (8aS,9aR)-2,3,4,5,6,7,8,8a,9,9a-decahydro-1H-carbazole |
|---|---|
| PubChem CID | 14003979 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (8aS,9aR)-2,3,4,5,6,7,8,8a,9,9a-decahydro-1H-carbazole |
| SMILES | C1CC[C@@H]2N[C@@H]3CCCCC3=C2C1 |
| InChI | InChI=1S/C12H19N/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h11-13H,1-8H2/t11-,12+ |
| InChIKey | LDTHQUBWYPOWIT-TXEJJXNPSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|