About 2-(2-fluorophenyl)acetyl chloride
2-(2-fluorophenyl)acetyl chloride (PubChem CID 14004011) has the molecular formula C8H6ClFO
and a molecular weight of 172.59 g/mol. Its IUPAC name is 2-(2-fluorophenyl)acetyl chloride.
Molecular Properties
| Compound Name | 2-(2-fluorophenyl)acetyl chloride |
| PubChem CID | 14004011 |
| Molecular Formula | C8H6ClFO |
| Molecular Weight | 172.59 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 2-(2-fluorophenyl)acetyl chloride |
| SMILES | O=C(Cl)Cc1ccccc1F |
| InChI | InChI=1S/C8H6ClFO/c9-8(11)5-6-3-1-2-4-7(6)10/h1-4H,5H2 |
| InChIKey | KUMKNGTWQNSAQW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.59 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-fluorophenyl)acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenyl)acetyl chloride?
The IUPAC name of 2-(2-fluorophenyl)acetyl chloride (CID 14004011) is 2-(2-fluorophenyl)acetyl chloride.
What is the SMILES notation for 2-(2-fluorophenyl)acetyl chloride?
The canonical SMILES for 2-(2-fluorophenyl)acetyl chloride is O=C(Cl)Cc1ccccc1F.
What is the InChIKey of 2-(2-fluorophenyl)acetyl chloride?
The InChIKey is KUMKNGTWQNSAQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClFO/c9-8(11)5-6-3-1-2-4-7(6)10/h1-4H,5H2.
What are the key properties of 2-(2-fluorophenyl)acetyl chloride?
2-(2-fluorophenyl)acetyl chloride has a molecular weight of 172.59 g/mol, XLogP of 2.13, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenyl)acetyl chloride is sourced from PubChem (CID 14004011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).