C15H17NO — CID 14004040
2,3,4,6,7,12b-hexahydro-1H-[1]benzofuro[2,3-a]quinolizine (PubChem CID 14004040) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 2,3,4,6,7,12b-hexahydro-1H-[1]benzofuro[2,3-a]quinolizine.
| Compound Name | 2,3,4,6,7,12b-hexahydro-1H-[1]benzofuro[2,3-a]quinolizine |
|---|---|
| PubChem CID | 14004040 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2,3,4,6,7,12b-hexahydro-1H-[1]benzofuro[2,3-a]quinolizine |
| SMILES | c1ccc2c3c(oc2c1)C1CCCCN1CC3 |
| InChI | InChI=1S/C15H17NO/c1-2-7-14-11(5-1)12-8-10-16-9-4-3-6-13(16)15(12)17-14/h1-2,5,7,13H,3-4,6,8-10H2 |
| InChIKey | WVLAAGBGTBJXIQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |