C13H19N — CID 14004187
(7Z)-2-methyl-1,3,4,5,6,11a-hexahydro-2-benzazonine (PubChem CID 14004187) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (7Z)-2-methyl-1,3,4,5,6,11a-hexahydro-2-benzazonine.
| Compound Name | (7Z)-2-methyl-1,3,4,5,6,11a-hexahydro-2-benzazonine |
|---|---|
| PubChem CID | 14004187 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (7Z)-2-methyl-1,3,4,5,6,11a-hexahydro-2-benzazonine |
| SMILES | CN1CCCC/C=C2/C=CC=CC2C1 |
| InChI | InChI=1S/C13H19N/c1-14-10-6-2-3-7-12-8-4-5-9-13(12)11-14/h4-5,7-9,13H,2-3,6,10-11H2,1H3/b12-7- |
| InChIKey | CQAHCEQDORBOKH-GHXNOFRVSA-N |
| XLogP | 2.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |