C14H21N — CID 14004189
(7E)-2,8-dimethyl-1,3,4,5,6,11a-hexahydro-2-benzazonine (PubChem CID 14004189) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (7E)-2,8-dimethyl-1,3,4,5,6,11a-hexahydro-2-benzazonine.
| Compound Name | (7E)-2,8-dimethyl-1,3,4,5,6,11a-hexahydro-2-benzazonine |
|---|---|
| PubChem CID | 14004189 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (7E)-2,8-dimethyl-1,3,4,5,6,11a-hexahydro-2-benzazonine |
| SMILES | CC1=CC=CC2CN(C)CCCC/C=C/12 |
| InChI | InChI=1S/C14H21N/c1-12-7-6-8-13-11-15(2)10-5-3-4-9-14(12)13/h6-9,13H,3-5,10-11H2,1-2H3/b14-9- |
| InChIKey | MVAPTOUZYNGQPD-ZROIWOOFSA-N |
| XLogP | 3.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |