C14H17NO — CID 14004790
6-methoxy-2,3,4,4a,5,10-hexahydrobenzo[g]quinoline (PubChem CID 14004790) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 6-methoxy-2,3,4,4a,5,10-hexahydrobenzo[g]quinoline.
| Compound Name | 6-methoxy-2,3,4,4a,5,10-hexahydrobenzo[g]quinoline |
|---|---|
| PubChem CID | 14004790 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 6-methoxy-2,3,4,4a,5,10-hexahydrobenzo[g]quinoline |
| SMILES | COc1cccc2c1CC1CCCN=C1C2 |
| InChI | InChI=1S/C14H17NO/c1-16-14-6-2-4-10-9-13-11(8-12(10)14)5-3-7-15-13/h2,4,6,11H,3,5,7-9H2,1H3 |
| InChIKey | HPLJFGBZEFITHV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |