About trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol
trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol (PubChem CID 14005678) has the molecular formula C10H14OS
and a molecular weight of 182.29 g/mol. Its IUPAC name is trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol.
Molecular Properties
| Compound Name | trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol |
| PubChem CID | 14005678 |
| Molecular Formula | C10H14OS |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C10H14OS/c11-10-4-2-1-3-9(10)8-5-6-12-7-8/h5-7,9-11H,1-4H2/t9-,10+/m1/s1 |
| InChIKey | MGQFSPUSGVUREY-ZJUUUORDSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol?
The IUPAC name of trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol (CID 14005678) is trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol.
What is the SMILES notation for trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol?
The canonical SMILES for trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol is O[C@H]1CCCC[C@@H]1c1ccsc1.
What is the InChIKey of trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol?
The InChIKey is MGQFSPUSGVUREY-ZJUUUORDSA-N. The full InChI is InChI=1S/C10H14OS/c11-10-4-2-1-3-9(10)8-5-6-12-7-8/h5-7,9-11H,1-4H2/t9-,10+/m1/s1.
What are the key properties of trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol?
trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol has a molecular weight of 182.29 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-2-thiophen-3-ylcyclohexan-1-ol is sourced from PubChem (CID 14005678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).