C22H14N6Na2O9S2 — CID 14006
CID 14006 (PubChem CID 14006) has the molecular formula C22H14N6Na2O9S2 and a molecular weight of 616.50 g/mol. Its IUPAC name is disodium;4-imino-3-[(4-nitrophenyl)hydrazinylidene]-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonate.
| Compound Name | CID 14006 |
|---|---|
| PubChem CID | 14006 |
| Molecular Formula | C22H14N6Na2O9S2 |
| Molecular Weight | 616.50 g/mol |
| Exact Mass | 616.01 |
| IUPAC Name | disodium;4-imino-3-[(4-nitrophenyl)hydrazinylidene]-5-oxo-6-(phenylhydrazinylidene)naphthalene-2,7-disulfonate |
| SMILES | C1=CC=C(C=C1)NN=C2C(=CC3=C(C2=O)C(=N)C(=NNC4=CC=C(C=C4)[N+](=O)[O-])C(=C3)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| InChIKey | XEOJHCMDYSXAPG-UHFFFAOYSA-L |
| XLogP | N/A |
| TPSA | 267.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | 1420 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|