C12H9N3 — CID 14006057
2,2-dipyridin-2-ylacetonitrile (PubChem CID 14006057) has the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2,2-dipyridin-2-ylacetonitrile.
| Compound Name | 2,2-dipyridin-2-ylacetonitrile |
|---|---|
| PubChem CID | 14006057 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2,2-dipyridin-2-ylacetonitrile |
| SMILES | N#CC(c1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C12H9N3/c13-9-10(11-5-1-3-7-14-11)12-6-2-4-8-15-12/h1-8,10H |
| InChIKey | VVWJETKSWYYHER-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |