C25H56OSi2Sn — CID 14006077
tert-butyl-dimethyl-[(Z)-2-tributylstannyl-4-trimethylsilylbut-2-enoxy]silane (PubChem CID 14006077) has the molecular formula C25H56OSi2Sn and a molecular weight of 547.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z)-2-tributylstannyl-4-trimethylsilylbut-2-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z)-2-tributylstannyl-4-trimethylsilylbut-2-enoxy]silane |
|---|---|
| PubChem CID | 14006077 |
| Molecular Formula | C25H56OSi2Sn |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | tert-butyl-dimethyl-[(Z)-2-tributylstannyl-4-trimethylsilylbut-2-enoxy]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C\C[Si](C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H29OSi2.3C4H9.Sn/c1-13(2,3)16(7,8)14-11-9-10-12-15(4,5)6;3*1-3-4-2;/h10H,11-12H2,1-8H3;3*1,3-4H2,2H3; |
| InChIKey | WODHDVWHMVSZOE-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|