About 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane
6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane (PubChem CID 14006174) has the molecular formula C15H26Si
and a molecular weight of 234.46 g/mol. Its IUPAC name is 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane.
Molecular Properties
| Compound Name | 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane |
| PubChem CID | 14006174 |
| Molecular Formula | C15H26Si |
| Molecular Weight | 234.46 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane |
| SMILES | CC[Si](C#CC=C=CC(C)(C)C)(CC)CC |
| InChI | InChI=1S/C15H26Si/c1-7-16(8-2,9-3)14-12-10-11-13-15(4,5)6/h10,13H,7-9H2,1-6H3 |
| InChIKey | URGCNMPHIGCXNO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane?
The IUPAC name of 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane (CID 14006174) is 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane.
What is the SMILES notation for 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane?
The canonical SMILES for 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane is CC[Si](C#CC=C=CC(C)(C)C)(CC)CC.
What is the InChIKey of 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane?
The InChIKey is URGCNMPHIGCXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26Si/c1-7-16(8-2,9-3)14-12-10-11-13-15(4,5)6/h10,13H,7-9H2,1-6H3.
What are the key properties of 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane?
6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane has a molecular weight of 234.46 g/mol, XLogP of 4.79, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethylhepta-3,4-dien-1-ynyl(triethyl)silane is sourced from PubChem (CID 14006174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).