About 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine
7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine (PubChem CID 14006556) has the molecular formula C10H13ClN4
and a molecular weight of 224.69 g/mol. Its IUPAC name is 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine |
| PubChem CID | 14006556 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine |
| SMILES | Cc1nn(C)c2c(Cl)nc(C(C)C)nc12 |
| InChI | InChI=1S/C10H13ClN4/c1-5(2)10-12-7-6(3)14-15(4)8(7)9(11)13-10/h5H,1-4H3 |
| InChIKey | YHRMDYCTOBUEIB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine?
The IUPAC name of 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine (CID 14006556) is 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine.
What is the SMILES notation for 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine?
The canonical SMILES for 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine is Cc1nn(C)c2c(Cl)nc(C(C)C)nc12.
What is the InChIKey of 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine?
The InChIKey is YHRMDYCTOBUEIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN4/c1-5(2)10-12-7-6(3)14-15(4)8(7)9(11)13-10/h5H,1-4H3.
What are the key properties of 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine?
7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine has a molecular weight of 224.69 g/mol, XLogP of 2.45, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1,3-dimethyl-5-propan-2-ylpyrazolo[4,5-d]pyrimidine is sourced from PubChem (CID 14006556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).