About diethoxy-methyl-(3,3,3-trifluoropropyl)silane
diethoxy-methyl-(3,3,3-trifluoropropyl)silane (PubChem CID 14007317) has the molecular formula C8H17F3O2Si
and a molecular weight of 230.30 g/mol. Its IUPAC name is diethoxy-methyl-(3,3,3-trifluoropropyl)silane.
Molecular Properties
| Compound Name | diethoxy-methyl-(3,3,3-trifluoropropyl)silane |
| PubChem CID | 14007317 |
| Molecular Formula | C8H17F3O2Si |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | diethoxy-methyl-(3,3,3-trifluoropropyl)silane |
| SMILES | CCO[Si](C)(CCC(F)(F)F)OCC |
| InChI | InChI=1S/C8H17F3O2Si/c1-4-12-14(3,13-5-2)7-6-8(9,10)11/h4-7H2,1-3H3 |
| InChIKey | VJYNTADJZPKUAF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxy-methyl-(3,3,3-trifluoropropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy-methyl-(3,3,3-trifluoropropyl)silane?
The IUPAC name of diethoxy-methyl-(3,3,3-trifluoropropyl)silane (CID 14007317) is diethoxy-methyl-(3,3,3-trifluoropropyl)silane.
What is the SMILES notation for diethoxy-methyl-(3,3,3-trifluoropropyl)silane?
The canonical SMILES for diethoxy-methyl-(3,3,3-trifluoropropyl)silane is CCO[Si](C)(CCC(F)(F)F)OCC.
What is the InChIKey of diethoxy-methyl-(3,3,3-trifluoropropyl)silane?
The InChIKey is VJYNTADJZPKUAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17F3O2Si/c1-4-12-14(3,13-5-2)7-6-8(9,10)11/h4-7H2,1-3H3.
What are the key properties of diethoxy-methyl-(3,3,3-trifluoropropyl)silane?
diethoxy-methyl-(3,3,3-trifluoropropyl)silane has a molecular weight of 230.30 g/mol, XLogP of 3.08, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy-methyl-(3,3,3-trifluoropropyl)silane is sourced from PubChem (CID 14007317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).