C12F22 — CID 14007676
3,3,4,4-tetrafluoro-1,2-bis[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclobutene (PubChem CID 14007676) has the molecular formula C12F22 and a molecular weight of 562.09 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1,2-bis[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclobutene.
| Compound Name | 3,3,4,4-tetrafluoro-1,2-bis[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclobutene |
|---|---|
| PubChem CID | 14007676 |
| Molecular Formula | C12F22 |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.96 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1,2-bis[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclobutene |
| SMILES | FC(F)(F)C(C1=C(C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12F22/c13-5(14)1(3(7(17,18)19,8(20,21)22)9(23,24)25)2(6(5,15)16)4(10(26,27)28,11(29,30)31)12(32,33)34 |
| InChIKey | LWYFADRQHHCLJO-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|