C9F16 — CID 14007677
1,3,3,4,4,5,5-heptafluoro-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclopentene (PubChem CID 14007677) has the molecular formula C9F16 and a molecular weight of 412.07 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclopentene |
|---|---|
| PubChem CID | 14007677 |
| Molecular Formula | C9F16 |
| Molecular Weight | 412.07 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]cyclopentene |
| SMILES | FC1=C(C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9F16/c10-2-1(4(11,12)6(15,16)5(2,13)14)3(7(17,18)19,8(20,21)22)9(23,24)25 |
| InChIKey | MXTUCSWYHFZTCX-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.07 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|