About N-(4,4-diethoxybutyl)prop-2-enamide
N-(4,4-diethoxybutyl)prop-2-enamide (PubChem CID 14008504) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is N-(4,4-diethoxybutyl)prop-2-enamide.
Molecular Properties
| Compound Name | N-(4,4-diethoxybutyl)prop-2-enamide |
| PubChem CID | 14008504 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | N-(4,4-diethoxybutyl)prop-2-enamide |
| SMILES | C=CC(=O)NCCCC(OCC)OCC |
| InChI | InChI=1S/C11H21NO3/c1-4-10(13)12-9-7-8-11(14-5-2)15-6-3/h4,11H,1,5-9H2,2-3H3,(H,12,13) |
| InChIKey | JOEYXLNWOKHCJG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-diethoxybutyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-diethoxybutyl)prop-2-enamide?
The IUPAC name of N-(4,4-diethoxybutyl)prop-2-enamide (CID 14008504) is N-(4,4-diethoxybutyl)prop-2-enamide.
What is the SMILES notation for N-(4,4-diethoxybutyl)prop-2-enamide?
The canonical SMILES for N-(4,4-diethoxybutyl)prop-2-enamide is C=CC(=O)NCCCC(OCC)OCC.
What is the InChIKey of N-(4,4-diethoxybutyl)prop-2-enamide?
The InChIKey is JOEYXLNWOKHCJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-4-10(13)12-9-7-8-11(14-5-2)15-6-3/h4,11H,1,5-9H2,2-3H3,(H,12,13).
What are the key properties of N-(4,4-diethoxybutyl)prop-2-enamide?
N-(4,4-diethoxybutyl)prop-2-enamide has a molecular weight of 215.29 g/mol, XLogP of 1.47, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-diethoxybutyl)prop-2-enamide is sourced from PubChem (CID 14008504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).