C21H11ClN2O3 — CID 14008641
3-(3-chlorophenyl)-1H-naphtho[3,2-e]benzimidazole-2,6,11-trione (PubChem CID 14008641) has the molecular formula C21H11ClN2O3 and a molecular weight of 374.78 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1H-naphtho[3,2-e]benzimidazole-2,6,11-trione.
| Compound Name | 3-(3-chlorophenyl)-1H-naphtho[3,2-e]benzimidazole-2,6,11-trione |
|---|---|
| PubChem CID | 14008641 |
| Molecular Formula | C21H11ClN2O3 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 3-(3-chlorophenyl)-1H-naphtho[3,2-e]benzimidazole-2,6,11-trione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1c2[nH]c(=O)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H11ClN2O3/c22-11-4-3-5-12(10-11)24-16-9-8-15-17(18(16)23-21(24)27)20(26)14-7-2-1-6-13(14)19(15)25/h1-10H,(H,23,27) |
| InChIKey | KFGWRCGBBSXBFG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|