C16H10Cl3N3 — CID 14008675
2-[2,3,5-trichloro-4-[4-(dimethylamino)phenyl]cyclopenta-2,4-dien-1-ylidene]propanedinitrile (PubChem CID 14008675) has the molecular formula C16H10Cl3N3 and a molecular weight of 350.64 g/mol. Its IUPAC name is 2-[2,3,5-trichloro-4-[4-(dimethylamino)phenyl]cyclopenta-2,4-dien-1-ylidene]propanedinitrile.
| Compound Name | 2-[2,3,5-trichloro-4-[4-(dimethylamino)phenyl]cyclopenta-2,4-dien-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 14008675 |
| Molecular Formula | C16H10Cl3N3 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 2-[2,3,5-trichloro-4-[4-(dimethylamino)phenyl]cyclopenta-2,4-dien-1-ylidene]propanedinitrile |
| SMILES | CN(C)c1ccc(C2=C(Cl)C(=C(C#N)C#N)C(Cl)=C2Cl)cc1 |
| InChI | InChI=1S/C16H10Cl3N3/c1-22(2)11-5-3-9(4-6-11)12-14(17)13(10(7-20)8-21)16(19)15(12)18/h3-6H,1-2H3 |
| InChIKey | BRDCGWPPBMICDF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|