C6H5F5O3 — CID 14008832
4-(2,2,3,3,3-pentafluoropropyl)-1,3-dioxolan-2-one (PubChem CID 14008832) has the molecular formula C6H5F5O3 and a molecular weight of 220.09 g/mol. Its IUPAC name is 4-(2,2,3,3,3-pentafluoropropyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(2,2,3,3,3-pentafluoropropyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 14008832 |
| Molecular Formula | C6H5F5O3 |
| Molecular Weight | 220.09 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 4-(2,2,3,3,3-pentafluoropropyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(CC(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C6H5F5O3/c7-5(8,6(9,10)11)1-3-2-13-4(12)14-3/h3H,1-2H2 |
| InChIKey | MOVBXKCIDZBISV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.09 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|