C10H5F13O3 — CID 14008833
4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)-1,3-dioxolan-2-one (PubChem CID 14008833) has the molecular formula C10H5F13O3 and a molecular weight of 420.12 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 14008833 |
| Molecular Formula | C10H5F13O3 |
| Molecular Weight | 420.12 g/mol |
| Exact Mass | 420.00 |
| IUPAC Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C10H5F13O3/c11-5(12,1-3-2-25-4(24)26-3)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h3H,1-2H2 |
| InChIKey | PXAIBOJBLYQOTQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.12 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|