About 2-Selenoxo-1,3-thiazolidin-4-one
2-Selenoxo-1,3-thiazolidin-4-one (PubChem CID 14008848) has the molecular formula C3H2NOSSe
and a molecular weight of 179.08 g/mol.
Molecular Properties
| Compound Name | 2-Selenoxo-1,3-thiazolidin-4-one |
| PubChem CID | 14008848 |
| Molecular Formula | C3H2NOSSe |
| Molecular Weight | 179.08 g/mol |
| Exact Mass | 179.90 |
| IUPAC Name | — |
| SMILES | O=C1CSC([Se])=N1 |
| InChI | InChI=1S/C3H2NOSSe/c5-2-1-6-3(7)4-2/h1H2 |
| InChIKey | UELRCPVLFSPPBF-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.08 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-Selenoxo-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Selenoxo-1,3-thiazolidin-4-one?
The IUPAC name of 2-Selenoxo-1,3-thiazolidin-4-one (CID 14008848) is not available.
What is the SMILES notation for 2-Selenoxo-1,3-thiazolidin-4-one?
The canonical SMILES for 2-Selenoxo-1,3-thiazolidin-4-one is O=C1CSC([Se])=N1.
What is the InChIKey of 2-Selenoxo-1,3-thiazolidin-4-one?
The InChIKey is UELRCPVLFSPPBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2NOSSe/c5-2-1-6-3(7)4-2/h1H2.
What are the key properties of 2-Selenoxo-1,3-thiazolidin-4-one?
2-Selenoxo-1,3-thiazolidin-4-one has a molecular weight of 179.08 g/mol, XLogP of -0.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Selenoxo-1,3-thiazolidin-4-one is sourced from PubChem (CID 14008848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).