C11H15NO3 — CID 14009054
ethyl 2-amino-3-(2-hydroxyphenyl)propanoate (PubChem CID 14009054) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is ethyl 2-amino-3-(2-hydroxyphenyl)propanoate.
| Compound Name | ethyl 2-amino-3-(2-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 14009054 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | ethyl 2-amino-3-(2-hydroxyphenyl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccccc1O |
| InChI | InChI=1S/C11H15NO3/c1-2-15-11(14)9(12)7-8-5-3-4-6-10(8)13/h3-6,9,13H,2,7,12H2,1H3 |
| InChIKey | AKXACSSFMCWJOB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |