C13H20 — CID 14009268
2,3,4,5,6,7,8,8a,9,9a-decahydro-1H-fluorene (PubChem CID 14009268) has the molecular formula C13H20 and a molecular weight of 176.30 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,8a,9,9a-decahydro-1H-fluorene.
| Compound Name | 2,3,4,5,6,7,8,8a,9,9a-decahydro-1H-fluorene |
|---|---|
| PubChem CID | 14009268 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 2,3,4,5,6,7,8,8a,9,9a-decahydro-1H-fluorene |
| SMILES | C1CCC2CC3CCCCC3=C2C1 |
| InChI | InChI=1S/C13H20/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h10-11H,1-9H2 |
| InChIKey | MKXAZJQDNHEIDE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|