C16H4Cl6O8 — CID 14009273
2-[2-(2-carboxy-3,4,6-trichlorophenoxy)-2-oxoacetyl]oxy-3,5,6-trichlorobenzoic acid (PubChem CID 14009273) has the molecular formula C16H4Cl6O8 and a molecular weight of 536.92 g/mol. Its IUPAC name is 2-[2-(2-carboxy-3,4,6-trichlorophenoxy)-2-oxoacetyl]oxy-3,5,6-trichlorobenzoic acid.
| Compound Name | 2-[2-(2-carboxy-3,4,6-trichlorophenoxy)-2-oxoacetyl]oxy-3,5,6-trichlorobenzoic acid |
|---|---|
| PubChem CID | 14009273 |
| Molecular Formula | C16H4Cl6O8 |
| Molecular Weight | 536.92 g/mol |
| Exact Mass | 533.80 |
| IUPAC Name | 2-[2-(2-carboxy-3,4,6-trichlorophenoxy)-2-oxoacetyl]oxy-3,5,6-trichlorobenzoic acid |
| SMILES | O=C(Oc1c(Cl)cc(Cl)c(Cl)c1C(=O)O)C(=O)Oc1c(Cl)cc(Cl)c(Cl)c1C(=O)O |
| InChI | InChI=1S/C16H4Cl6O8/c17-3-1-5(19)11(7(9(3)21)13(23)24)29-15(27)16(28)30-12-6(20)2-4(18)10(22)8(12)14(25)26/h1-2H,(H,23,24)(H,25,26) |
| InChIKey | UICHTVDWXUXMGB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.92 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|