About zinc bis(propan-2-olate)
zinc bis(propan-2-olate) (PubChem CID 14009701) has the molecular formula C6H14O2Zn
and a molecular weight of 183.57 g/mol. Its IUPAC name is zinc bis(propan-2-olate).
Molecular Properties
| Compound Name | zinc bis(propan-2-olate) |
| PubChem CID | 14009701 |
| Molecular Formula | C6H14O2Zn |
| Molecular Weight | 183.57 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | zinc bis(propan-2-olate) |
| SMILES | CC(C)[O-].CC(C)[O-].[Zn+2] |
| InChI | InChI=1S/2C3H7O.Zn/c2*1-3(2)4;/h2*3H,1-2H3;/q2*-1;+2 |
| InChIKey | HKIRVJCLEHCVAL-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.57 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc bis(propan-2-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc bis(propan-2-olate)?
The IUPAC name of zinc bis(propan-2-olate) (CID 14009701) is zinc bis(propan-2-olate).
What is the SMILES notation for zinc bis(propan-2-olate)?
The canonical SMILES for zinc bis(propan-2-olate) is CC(C)[O-].CC(C)[O-].[Zn+2].
What is the InChIKey of zinc bis(propan-2-olate)?
The InChIKey is HKIRVJCLEHCVAL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H7O.Zn/c2*1-3(2)4;/h2*3H,1-2H3;/q2*-1;+2.
What are the key properties of zinc bis(propan-2-olate)?
zinc bis(propan-2-olate) has a molecular weight of 183.57 g/mol, XLogP of -0.49, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc bis(propan-2-olate) is sourced from PubChem (CID 14009701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).