C8H18N2O2 — CID 14009886
N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]ethane-1,2-diamine (PubChem CID 14009886) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 14009886 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]ethane-1,2-diamine |
| SMILES | CC1(C)OCC(CNCCN)O1 |
| InChI | InChI=1S/C8H18N2O2/c1-8(2)11-6-7(12-8)5-10-4-3-9/h7,10H,3-6,9H2,1-2H3 |
| InChIKey | BNJIFIMQEKZPKW-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|