About [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate
[4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate (PubChem CID 14010416) has the molecular formula C22H26O6S
and a molecular weight of 418.51 g/mol. Its IUPAC name is [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate |
| PubChem CID | 14010416 |
| Molecular Formula | C22H26O6S |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1ccc(S(=O)(=O)c2ccc(OC(=O)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H26O6S/c1-21(2,3)19(23)27-15-7-11-17(12-8-15)29(25,26)18-13-9-16(10-14-18)28-20(24)22(4,5)6/h7-14H,1-6H3 |
| InChIKey | DYVPPEBHFAGTDY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate?
The IUPAC name of [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate (CID 14010416) is [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate?
The canonical SMILES for [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate is CC(C)(C)C(=O)Oc1ccc(S(=O)(=O)c2ccc(OC(=O)C(C)(C)C)cc2)cc1.
What is the InChIKey of [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate?
The InChIKey is DYVPPEBHFAGTDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O6S/c1-21(2,3)19(23)27-15-7-11-17(12-8-15)29(25,26)18-13-9-16(10-14-18)28-20(24)22(4,5)6/h7-14H,1-6H3.
What are the key properties of [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate?
[4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate has a molecular weight of 418.51 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(2,2-dimethylpropanoyloxy)phenyl]sulfonylphenyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 14010416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).