About 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide
1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide (PubChem CID 14010656) has the molecular formula C8H10N2O3
and a molecular weight of 182.18 g/mol. Its IUPAC name is 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide.
Molecular Properties
| Compound Name | 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide |
| PubChem CID | 14010656 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide |
| SMILES | CN(C)C(=O)c1cccc(=O)n1O |
| InChI | InChI=1S/C8H10N2O3/c1-9(2)8(12)6-4-3-5-7(11)10(6)13/h3-5,13H,1-2H3 |
| InChIKey | ZBFBIERQWORYLE-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide?
The IUPAC name of 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide (CID 14010656) is 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide.
What is the SMILES notation for 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide?
The canonical SMILES for 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide is CN(C)C(=O)c1cccc(=O)n1O.
What is the InChIKey of 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide?
The InChIKey is ZBFBIERQWORYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-9(2)8(12)6-4-3-5-7(11)10(6)13/h3-5,13H,1-2H3.
What are the key properties of 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide?
1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide has a molecular weight of 182.18 g/mol, XLogP of -0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-N,N-dimethyl-6-oxopyridine-2-carboxamide is sourced from PubChem (CID 14010656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).