C32H46O2 — CID 14011547
2-[(1E,3E,5E,7E,9E,11E,13E,15E)-17,17-dimethoxy-3,7,11,15-tetramethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]-1,3,3-trimethylcyclohexene (PubChem CID 14011547) has the molecular formula C32H46O2 and a molecular weight of 462.72 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E,9E,11E,13E,15E)-17,17-dimethoxy-3,7,11,15-tetramethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7E,9E,11E,13E,15E)-17,17-dimethoxy-3,7,11,15-tetramethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 14011547 |
| Molecular Formula | C32H46O2 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | 2-[(1E,3E,5E,7E,9E,11E,13E,15E)-17,17-dimethoxy-3,7,11,15-tetramethylheptadeca-1,3,5,7,9,11,13,15-octaenyl]-1,3,3-trimethylcyclohexene |
| SMILES | COC(/C=C(C)/C=C/C=C(C)/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)OC |
| InChI | InChI=1S/C32H46O2/c1-25(14-10-15-26(2)17-12-19-28(4)24-31(33-8)34-9)16-11-18-27(3)21-22-30-29(5)20-13-23-32(30,6)7/h10-12,14-19,21-22,24,31H,13,20,23H2,1-9H3/b15-10+,16-11+,19-12+,22-21+,25-14+,26-17+,27-18+,28-24+ |
| InChIKey | WPVOLBQVQSAATR-POVRBPGNSA-N |
| XLogP | 9.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|