C11H10F4N2O4 — CID 14011572
N-[4-methyl-2-nitro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]acetamide (PubChem CID 14011572) has the molecular formula C11H10F4N2O4 and a molecular weight of 310.20 g/mol. Its IUPAC name is N-[4-methyl-2-nitro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]acetamide.
| Compound Name | N-[4-methyl-2-nitro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 14011572 |
| Molecular Formula | C11H10F4N2O4 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-[4-methyl-2-nitro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(OC(F)(F)C(F)F)c(C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10F4N2O4/c1-5-3-8(17(19)20)7(16-6(2)18)4-9(5)21-11(14,15)10(12)13/h3-4,10H,1-2H3,(H,16,18) |
| InChIKey | HNSXGNHNOBTKBE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|