About 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide
4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide (PubChem CID 14012369) has the molecular formula C19H28N4O
and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide.
Molecular Properties
| Compound Name | 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide |
| PubChem CID | 14012369 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide |
| SMILES | CCCCNc1c(C(=O)NCCC)nnc2c(CCC)cccc12 |
| InChI | InChI=1S/C19H28N4O/c1-4-7-13-20-17-15-11-8-10-14(9-5-2)16(15)22-23-18(17)19(24)21-12-6-3/h8,10-11H,4-7,9,12-13H2,1-3H3,(H,20,22)(H,21,24) |
| InChIKey | BXPHKCZGQFRYOA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide?
The IUPAC name of 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide (CID 14012369) is 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide.
What is the SMILES notation for 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide?
The canonical SMILES for 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide is CCCCNc1c(C(=O)NCCC)nnc2c(CCC)cccc12.
What is the InChIKey of 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide?
The InChIKey is BXPHKCZGQFRYOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4O/c1-4-7-13-20-17-15-11-8-10-14(9-5-2)16(15)22-23-18(17)19(24)21-12-6-3/h8,10-11H,4-7,9,12-13H2,1-3H3,(H,20,22)(H,21,24).
What are the key properties of 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide?
4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide has a molecular weight of 328.46 g/mol, XLogP of 3.93, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butylamino)-N,8-dipropylcinnoline-3-carboxamide is sourced from PubChem (CID 14012369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).