C14H10Cl2FNO2 — CID 14012586
(NZ)-N-[(2,5-dichloro-4-methoxyphenyl)-(2-fluorophenyl)methylidene]hydroxylamine (PubChem CID 14012586) has the molecular formula C14H10Cl2FNO2 and a molecular weight of 314.14 g/mol. Its IUPAC name is (NZ)-N-[(2,5-dichloro-4-methoxyphenyl)-(2-fluorophenyl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2,5-dichloro-4-methoxyphenyl)-(2-fluorophenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 14012586 |
| Molecular Formula | C14H10Cl2FNO2 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | (NZ)-N-[(2,5-dichloro-4-methoxyphenyl)-(2-fluorophenyl)methylidene]hydroxylamine |
| SMILES | COc1cc(Cl)c(/C(=N\O)c2ccccc2F)cc1Cl |
| InChI | InChI=1S/C14H10Cl2FNO2/c1-20-13-7-10(15)9(6-11(13)16)14(18-19)8-4-2-3-5-12(8)17/h2-7,19H,1H3/b18-14- |
| InChIKey | IWZZMSIFXHJIJA-JXAWBTAJSA-N |
| XLogP | 4.37 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|