About 3-(chloromethyl)-1,2,4-thiadiazol-5-amine
3-(chloromethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 14012604) has the molecular formula C3H4ClN3S
and a molecular weight of 149.61 g/mol. Its IUPAC name is 3-(chloromethyl)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-(chloromethyl)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 14012604 |
| Molecular Formula | C3H4ClN3S |
| Molecular Weight | 149.61 g/mol |
| Exact Mass | 148.98 |
| IUPAC Name | 3-(chloromethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(CCl)ns1 |
| InChI | InChI=1S/C3H4ClN3S/c4-1-2-6-3(5)8-7-2/h1H2,(H2,5,6,7) |
| InChIKey | LXBKUXZCSXPODH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.61 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-(chloromethyl)-1,2,4-thiadiazol-5-amine (CID 14012604) is 3-(chloromethyl)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-(chloromethyl)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-(chloromethyl)-1,2,4-thiadiazol-5-amine is Nc1nc(CCl)ns1.
What is the InChIKey of 3-(chloromethyl)-1,2,4-thiadiazol-5-amine?
The InChIKey is LXBKUXZCSXPODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4ClN3S/c4-1-2-6-3(5)8-7-2/h1H2,(H2,5,6,7).
What are the key properties of 3-(chloromethyl)-1,2,4-thiadiazol-5-amine?
3-(chloromethyl)-1,2,4-thiadiazol-5-amine has a molecular weight of 149.61 g/mol, XLogP of 0.86, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 14012604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).