C28H34O2S — CID 14012843
(8S,11R,13S,14S,17R)-13-methyl-11-(4-methylsulfanylphenyl)spiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one (PubChem CID 14012843) has the molecular formula C28H34O2S and a molecular weight of 434.65 g/mol. Its IUPAC name is (8S,11R,13S,14S,17R)-13-methyl-11-(4-methylsulfanylphenyl)spiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one.
| Compound Name | (8S,11R,13S,14S,17R)-13-methyl-11-(4-methylsulfanylphenyl)spiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one |
|---|---|
| PubChem CID | 14012843 |
| Molecular Formula | C28H34O2S |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | (8S,11R,13S,14S,17R)-13-methyl-11-(4-methylsulfanylphenyl)spiro[1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17,2'-oxolane]-3-one |
| SMILES | CSc1ccc([C@H]2C[C@@]3(C)[C@@H](CC[C@@]34CCCO4)[C@@H]3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C28H34O2S/c1-27-17-24(18-4-8-21(31-2)9-5-18)26-22-11-7-20(29)16-19(22)6-10-23(26)25(27)12-14-28(27)13-3-15-30-28/h4-5,8-9,16,23-25H,3,6-7,10-15,17H2,1-2H3/t23-,24+,25-,27-,28-/m0/s1 |
| InChIKey | PGJFXWWZKGLBCO-WKWWZUSTSA-N |
| XLogP | 6.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |