About 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea
1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea (PubChem CID 14014028) has the molecular formula C14H17FN4O4S2
and a molecular weight of 388.45 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea.
Molecular Properties
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea |
| PubChem CID | 14014028 |
| Molecular Formula | C14H17FN4O4S2 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea |
| SMILES | Cc1cc(C)nc(NC(=O)NS(=O)(=O)c2sccc2COCCF)n1 |
| InChI | InChI=1S/C14H17FN4O4S2/c1-9-7-10(2)17-13(16-9)18-14(20)19-25(21,22)12-11(3-6-24-12)8-23-5-4-15/h3,6-7H,4-5,8H2,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | MPBDMHYTDKMMKJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea?
The IUPAC name of 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea (CID 14014028) is 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea.
What is the SMILES notation for 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea?
The canonical SMILES for 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea is Cc1cc(C)nc(NC(=O)NS(=O)(=O)c2sccc2COCCF)n1.
What is the InChIKey of 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea?
The InChIKey is MPBDMHYTDKMMKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FN4O4S2/c1-9-7-10(2)17-13(16-9)18-14(20)19-25(21,22)12-11(3-6-24-12)8-23-5-4-15/h3,6-7H,4-5,8H2,1-2H3,(H2,16,17,18,19,20).
What are the key properties of 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea?
1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea has a molecular weight of 388.45 g/mol, XLogP of 2.15, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,6-dimethylpyrimidin-2-yl)-3-[3-(2-fluoroethoxymethyl)thiophen-2-yl]sulfonylurea is sourced from PubChem (CID 14014028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).