C30H40O5S — CID 14015556
4-[[(Z,4R,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]benzoic acid (PubChem CID 14015556) has the molecular formula C30H40O5S and a molecular weight of 512.71 g/mol. Its IUPAC name is 4-[[(Z,4R,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]benzoic acid.
| Compound Name | 4-[[(Z,4R,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 14015556 |
| Molecular Formula | C30H40O5S |
| Molecular Weight | 512.71 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 4-[[(Z,4R,5S)-8-carboxy-1-(4-heptylphenyl)-5-hydroxyoct-2-en-4-yl]sulfanylmethyl]benzoic acid |
| SMILES | CCCCCCCc1ccc(C/C=C\[C@@H](SCc2ccc(C(=O)O)cc2)[C@@H](O)CCCC(=O)O)cc1 |
| InChI | InChI=1S/C30H40O5S/c1-2-3-4-5-6-9-23-14-16-24(17-15-23)10-7-12-28(27(31)11-8-13-29(32)33)36-22-25-18-20-26(21-19-25)30(34)35/h7,12,14-21,27-28,31H,2-6,8-11,13,22H2,1H3,(H,32,33)(H,34,35)/b12-7-/t27-,28+/m0/s1 |
| InChIKey | KLXCTWUJNWZXCC-QUCVIOJBSA-N |
| XLogP | 6.91 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.71 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|