C21H26O11S — CID 14015827
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(benzenesulfonylmethyl)oxan-2-yl]methyl acetate (PubChem CID 14015827) has the molecular formula C21H26O11S and a molecular weight of 486.50 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(benzenesulfonylmethyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(benzenesulfonylmethyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 14015827 |
| Molecular Formula | C21H26O11S |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(benzenesulfonylmethyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](CS(=O)(=O)c2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H26O11S/c1-12(22)28-10-17-19(29-13(2)23)21(31-15(4)25)20(30-14(3)24)18(32-17)11-33(26,27)16-8-6-5-7-9-16/h5-9,17-21H,10-11H2,1-4H3/t17-,18+,19-,20+,21+/m1/s1 |
| InChIKey | OEIKDFNWMZYAIZ-TXVWBRJLSA-N |
| XLogP | 0.59 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|