C15H19NO — CID 14015852
(2E,8Z)-N-(3-methylbutyl)deca-2,8-dien-4,6-diynamide (PubChem CID 14015852) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (2E,8Z)-N-(3-methylbutyl)deca-2,8-dien-4,6-diynamide.
| Compound Name | (2E,8Z)-N-(3-methylbutyl)deca-2,8-dien-4,6-diynamide |
|---|---|
| PubChem CID | 14015852 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (2E,8Z)-N-(3-methylbutyl)deca-2,8-dien-4,6-diynamide |
| SMILES | C/C=C\C#CC#C/C=C/C(=O)NCCC(C)C |
| InChI | InChI=1S/C15H19NO/c1-4-5-6-7-8-9-10-11-15(17)16-13-12-14(2)3/h4-5,10-11,14H,12-13H2,1-3H3,(H,16,17)/b5-4-,11-10+ |
| InChIKey | BEAQKKODETVWOS-JWPKELMXSA-N |
| XLogP | 2.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|