C14H17NO — CID 14015861
(2E,8E)-N-(2-methylpropyl)deca-2,8-dien-4,6-diynamide (PubChem CID 14015861) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (2E,8E)-N-(2-methylpropyl)deca-2,8-dien-4,6-diynamide.
| Compound Name | (2E,8E)-N-(2-methylpropyl)deca-2,8-dien-4,6-diynamide |
|---|---|
| PubChem CID | 14015861 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (2E,8E)-N-(2-methylpropyl)deca-2,8-dien-4,6-diynamide |
| SMILES | C/C=C/C#CC#C/C=C/C(=O)NCC(C)C |
| InChI | InChI=1S/C14H17NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h4-5,10-11,13H,12H2,1-3H3,(H,15,16)/b5-4+,11-10+ |
| InChIKey | WYWJSGONLKGLJA-PMXBNEBOSA-N |
| XLogP | 1.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|