C17H16O5 — CID 14017329
5,9-dihydroxy-4-methoxy-11-oxatetracyclo[7.7.1.01,12.02,7]heptadeca-2,4,6,12,15-pentaen-14-one (PubChem CID 14017329) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 5,9-dihydroxy-4-methoxy-11-oxatetracyclo[7.7.1.01,12.02,7]heptadeca-2,4,6,12,15-pentaen-14-one.
| Compound Name | 5,9-dihydroxy-4-methoxy-11-oxatetracyclo[7.7.1.01,12.02,7]heptadeca-2,4,6,12,15-pentaen-14-one |
|---|---|
| PubChem CID | 14017329 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 5,9-dihydroxy-4-methoxy-11-oxatetracyclo[7.7.1.01,12.02,7]heptadeca-2,4,6,12,15-pentaen-14-one |
| SMILES | COc1cc2c(cc1O)CC1(O)COC3=CC(=O)C=CC32C1 |
| InChI | InChI=1S/C17H16O5/c1-21-14-6-12-10(4-13(14)19)7-16(20)8-17(12)3-2-11(18)5-15(17)22-9-16/h2-6,19-20H,7-9H2,1H3 |
| InChIKey | MRUMXAJTHTUMGP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |