C9H14O — CID 14017411
7,7-dimethylbicyclo[3.2.0]hept-2-en-6-ol (PubChem CID 14017411) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 7,7-dimethylbicyclo[3.2.0]hept-2-en-6-ol.
| Compound Name | 7,7-dimethylbicyclo[3.2.0]hept-2-en-6-ol |
|---|---|
| PubChem CID | 14017411 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 7,7-dimethylbicyclo[3.2.0]hept-2-en-6-ol |
| SMILES | CC1(C)C(O)C2CC=CC21 |
| InChI | InChI=1S/C9H14O/c1-9(2)7-5-3-4-6(7)8(9)10/h3,5-8,10H,4H2,1-2H3 |
| InChIKey | WVKVXQSNYVPRSV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|