C29H32FNO5 — CID 14017608
N-[(2S,3R,4R,5S,6S)-6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide (PubChem CID 14017608) has the molecular formula C29H32FNO5 and a molecular weight of 493.58 g/mol. Its IUPAC name is N-[(2S,3R,4R,5S,6S)-6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3R,4R,5S,6S)-6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 14017608 |
| Molecular Formula | C29H32FNO5 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | N-[(2S,3R,4R,5S,6S)-6-(fluoromethyl)-2,4,5-tris(phenylmethoxy)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@@H](OCc2ccccc2)O[C@H](CF)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H32FNO5/c1-21(32)31-26-28(34-19-23-13-7-3-8-14-23)27(33-18-22-11-5-2-6-12-22)25(17-30)36-29(26)35-20-24-15-9-4-10-16-24/h2-16,25-29H,17-20H2,1H3,(H,31,32)/t25-,26-,27-,28-,29+/m1/s1 |
| InChIKey | CNENJSGJNDRCHS-JPHCZMGXSA-N |
| XLogP | 4.57 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |