C29H32FNO5 — CID 14017623
N-[5-fluoro-2,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 14017623) has the molecular formula C29H32FNO5 and a molecular weight of 493.58 g/mol. Its IUPAC name is N-[5-fluoro-2,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[5-fluoro-2,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 14017623 |
| Molecular Formula | C29H32FNO5 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | N-[5-fluoro-2,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)NC1C(OCc2ccccc2)OC(COCc2ccccc2)C(F)C1OCc1ccccc1 |
| InChI | InChI=1S/C29H32FNO5/c1-21(32)31-27-28(34-18-23-13-7-3-8-14-23)26(30)25(20-33-17-22-11-5-2-6-12-22)36-29(27)35-19-24-15-9-4-10-16-24/h2-16,25-29H,17-20H2,1H3,(H,31,32) |
| InChIKey | ORJLIVANEREBDS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |