C25H21N5O4S — CID 1401780
4-[[[2-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 1401780) has the molecular formula C25H21N5O4S and a molecular weight of 487.54 g/mol. Its IUPAC name is 4-[[[2-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[[[2-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 1401780 |
| Molecular Formula | C25H21N5O4S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 4-[[[2-[[4-(4-methoxyphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | COc1ccc(-n2c(SCC(=O)NN=Cc3ccc(C(=O)O)cc3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N5O4S/c1-34-21-13-11-20(12-14-21)30-23(18-5-3-2-4-6-18)28-29-25(30)35-16-22(31)27-26-15-17-7-9-19(10-8-17)24(32)33/h2-15H,16H2,1H3,(H,27,31)(H,32,33) |
| InChIKey | NRKURKWHSIWFGV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|