C7H8O — CID 14017883
(1S,2S,4R,5R)-3-oxatricyclo[3.2.1.02,4]oct-6-ene (PubChem CID 14017883) has the molecular formula C7H8O and a molecular weight of 108.14 g/mol. Its IUPAC name is (1S,2S,4R,5R)-3-oxatricyclo[3.2.1.02,4]oct-6-ene.
| Compound Name | (1S,2S,4R,5R)-3-oxatricyclo[3.2.1.02,4]oct-6-ene |
|---|---|
| PubChem CID | 14017883 |
| Molecular Formula | C7H8O |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.06 |
| IUPAC Name | (1S,2S,4R,5R)-3-oxatricyclo[3.2.1.02,4]oct-6-ene |
| SMILES | C1=C[C@H]2C[C@@H]1[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C7H8O/c1-2-5-3-4(1)6-7(5)8-6/h1-2,4-7H,3H2/t4-,5+,6+,7- |
| InChIKey | YORASZMZQNWVEF-RNGGSSJXSA-N |
| XLogP | 0.96 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|