C30H50O — CID 14018532
2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-methyl-3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxirane (PubChem CID 14018532) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-methyl-3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxirane.
| Compound Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-methyl-3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxirane |
|---|---|
| PubChem CID | 14018532 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | 2-[(3E)-4,8-dimethylnona-3,7-dienyl]-2-methyl-3-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]oxirane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CCC1OC1(C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H50O/c1-24(2)14-9-16-26(5)18-11-19-27(6)20-12-22-29-30(8,31-29)23-13-21-28(7)17-10-15-25(3)4/h14-15,18,20-21,29H,9-13,16-17,19,22-23H2,1-8H3/b26-18+,27-20+,28-21+ |
| InChIKey | OZBVWSJPTAXJQA-JSFDVHLOSA-N |
| XLogP | 9.82 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|