C19H28O5S — CID 14019332
methyl (E)-8-hydroxy-4,8-dimethyl-2-(4-methylphenyl)sulfonylnon-3-enoate (PubChem CID 14019332) has the molecular formula C19H28O5S and a molecular weight of 368.50 g/mol. Its IUPAC name is methyl (E)-8-hydroxy-4,8-dimethyl-2-(4-methylphenyl)sulfonylnon-3-enoate.
| Compound Name | methyl (E)-8-hydroxy-4,8-dimethyl-2-(4-methylphenyl)sulfonylnon-3-enoate |
|---|---|
| PubChem CID | 14019332 |
| Molecular Formula | C19H28O5S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | methyl (E)-8-hydroxy-4,8-dimethyl-2-(4-methylphenyl)sulfonylnon-3-enoate |
| SMILES | COC(=O)C(/C=C(\C)CCCC(C)(C)O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H28O5S/c1-14-8-10-16(11-9-14)25(22,23)17(18(20)24-5)13-15(2)7-6-12-19(3,4)21/h8-11,13,17,21H,6-7,12H2,1-5H3/b15-13+ |
| InChIKey | QBWGUNYZXDDNLB-FYWRMAATSA-N |
| XLogP | 3.20 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|